Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A395 | Purity: >98% |
 | |
| Chemical structure of MK-3102 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1226781-44-7 |
|---|---|
| Purity | >98% |
| Formula | C17H20F2N4O3S |
| Mol Weight | 398.428 |
| CoA | CoA of MK-3102 |
| Smiles: | CS(=O)(=O)N1C=C2CN(CC2=N1)[C@H]1CO[C@@H]([C@@H](N)C1)C1=CC(F)=CC=C1F |
|---|
KEYWORDS: buy MK-3102 | MK-3102 supplier | purchase | cost | manufacturer | order | distributor | buy 1226781-44-7 | 1226781-44-7 supplier