Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3908 | Purity: >98% |
 | |
| Chemical structure of E3 Ligase Ligand-Linker Conjugates 2 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Pomalidomide-PEG4-Ph-NH2 |
|---|---|
| CAS No. | 1818885-63-0 |
| Purity | >98% |
| Formula | C27H32N4O8 |
| Mol Weight | 540.565 |
| CoA | CoA of E3 Ligase Ligand-Linker Conjugates 2 |
| Smiles: | O=C1N(C(CC2)C(NC2=O)=O)C(C3=C1C=CC=C3NCCOCCOCCOCCOC4=CC=C(N)C=C4)=O |
|---|
KEYWORDS: buy E3 Ligase Ligand-Linker Conjugates 2 | E3 Ligase Ligand-Linker Conjugates 2 supplier | purchase | cost | manufacturer | order | distributor | buy 1818885-63-0 | 1818885-63-0 supplier