Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A375 | Purity: >98% |
 | |
| Chemical structure of Desmethyl VS-5584 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1246535-95-4 |
|---|---|
| Purity | >98% |
| Formula | C16H20N8O |
| Mol Weight | 340.383 |
| CoA | CoA of Desmethyl VS-5584 |
| Smiles: | CC(C)N1C=NC2=C(N=C(N=C12)N1CCOCC1)C1=CN=C(N)N=C1 |
|---|
KEYWORDS: buy Desmethyl VS-5584 | Desmethyl VS-5584 supplier | purchase | cost | manufacturer | order | distributor | buy 1246535-95-4 | 1246535-95-4 supplier