Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3658 | Purity: >98% |
 | |
| Chemical structure of Oclacitinib maleate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PF-03394197 maleate |
|---|---|
| CAS No. | 1640292-55-2 |
| Purity | >98% |
| Formula | C19H27N5O6S |
| Mol Weight | 453.513 |
| CoA | CoA of Oclacitinib maleate |
| Smiles: | O=S(C[C@H]1CC[C@H](N(C)C2=C3C(NC=C3)=NC=N2)CC1)(NC)=O.O=C(O)/C=C\C(O)=O |
|---|
KEYWORDS: buy Oclacitinib maleate | Oclacitinib maleate supplier | purchase | cost | manufacturer | order | distributor | buy 1640292-55-2 | 1640292-55-2 supplier