Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3595 | Purity: >98% |
 | |
| Chemical structure of Etoposide phosphate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | BMY-40481 |
|---|---|
| CAS No. | 117091-64-2 |
| Purity | >98% |
| Formula | C29H33O16P |
| Mol Weight | 668.5365 |
| CoA | CoA of Etoposide phosphate |
| Smiles: | O=C1OC[C@]2([H])[C@H](O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO4)O3)O[C@@H]4C)O)O)C5=C(C=C6OCOC6=C5)[C@@H](C7=CC(OC)=C(OP(O)(O)=O)C(OC)=C7)[C@]21[H] |
|---|
KEYWORDS: buy Etoposide phosphate | Etoposide phosphate supplier | purchase | cost | manufacturer | order | distributor | buy 117091-64-2 | 117091-64-2 supplier