Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3546 | Purity: >98% |
 | |
| Chemical structure of Pexidartinib hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PLX-3397 hydrochloride |
|---|---|
| CAS No. | 2040295-03-0 |
| Purity | >98% |
| Formula | C20H16Cl2F3N5 |
| Mol Weight | 454.276 |
| CoA | CoA of Pexidartinib hydrochloride |
| Smiles: | FC(C1=CC=C(CNC2=NC=C(CC3=CNC4=NC=C(Cl)C=C43)C=C2)C=N1)(F)F.Cl |
|---|
KEYWORDS: buy Pexidartinib hydrochloride | Pexidartinib hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 2040295-03-0 | 2040295-03-0 supplier