Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11890 | Purity: >98% |
 | |
| Chemical structure of Monochlorobimane |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | mBCl |
|---|---|
| CAS No. | 76421-73-3 |
| Purity | >98% |
| Formula | C10H11ClN2O2 |
| Mol Weight | 226.66 |
| CoA | CoA of Monochlorobimane |
| Smiles: | CC1=C(N2C(=C(C(=O)N2C1=O)C)CCl)C |
|---|
KEYWORDS: buy Monochlorobimane | Monochlorobimane supplier | purchase | cost | manufacturer | order | distributor | buy 76421-73-3 | 76421-73-3 supplier