Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11364 | Purity: >98% |
 | |
| Chemical structure of AZD7687 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1166827-44-6 |
|---|---|
| Purity | >98% |
| Formula | C21H25N3O3 |
| Mol Weight | 367.4415 |
| CoA | CoA of AZD7687 |
| Smiles: | CC1=C(N=C(C(=N1)C)C(=O)N)C2=CC=C(C=C2)C3CCC(CC3)CC(=O)O |
|---|
KEYWORDS: buy AZD7687 | AZD7687 supplier | purchase | cost | manufacturer | order | distributor | buy 1166827-44-6 | 1166827-44-6 supplier