Product Information:
| Cat. No.: EX-A10816 | Purity: >98% |
![]() | |
| Chemical structure of Thalidomide-Propargyne-PEG1-COOH |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2828438-36-2 |
|---|---|
| Purity | >98% |
| Formula | C19H16N2O7 |
| Mol Weight | 384.3395 |
| CoA | CoA of Thalidomide-Propargyne-PEG1-COOH |
| Smiles: | OC(CCOCC#CC(C=C12)=CC=C2C(N(C1=O)C3CCC(NC3=O)=O)=O)=O |
|---|
KEYWORDS: buy Thalidomide-Propargyne-PEG1-COOH | Thalidomide-Propargyne-PEG1-COOH supplier | purchase | cost | manufacturer | order | distributor | buy 2828438-36-2 | 2828438-36-2 supplier


Inhibitor Specialist
