Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10799 | Purity: >98% |
 | |
| Chemical structure of ON-013100 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 865783-95-5 |
|---|---|
| Purity | >98% |
| Formula | C19H22O7S |
| Mol Weight | 394.439 |
| CoA | CoA of ON-013100 |
| Smiles: | OC1=CC(CS(=O)(/C=C/C2=C(OC)C=C(OC)C=C2OC)=O)=CC=C1OC |
|---|
KEYWORDS: buy ON-013100 | ON-013100 supplier | purchase | cost | manufacturer | order | distributor | buy 865783-95-5 | 865783-95-5 supplier