Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10048 | Purity: >98% |
 | |
| Chemical structure of SMARt751 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1616370-52-5 |
|---|---|
| Purity | >98% |
| Formula | C15H17F4NO |
| Mol Weight | 303.2952 |
| CoA | CoA of SMARt751 |
| Smiles: | O=C(N1CCC(C2=CC=C(F)C=C2)CC1)CCC(F)(F)F |
|---|
KEYWORDS: buy SMARt751 | SMARt751 supplier | purchase | cost | manufacturer | order | distributor | buy 1616370-52-5 | 1616370-52-5 supplier