Product Information:
| Cat. No.: EX-A11104 | Purity: >98% |
![]() | |
| Chemical structure of ONO-RS-082 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 99754-06-0 |
|---|---|
| Purity | >98% |
| Formula | C21H22ClNO3 |
| Mol Weight | 371.857 |
| CoA | CoA of ONO-RS-082 |
| Smiles: | ClC1=CC(NC(/C=C/C2=CC=C(C=C2)CCCCC)=O)=C(C=C1)C(O)=O |
|---|
KEYWORDS: buy ONO-RS-082 | ONO-RS-082 supplier | purchase | cost | manufacturer | order | distributor | buy 99754-06-0 | 99754-06-0 supplier


Inhibitor Specialist
