Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10193 | Purity: >98% |
 | |
| Chemical structure of Metoprine |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 7761-45-7 |
|---|---|
| Purity | >98% |
| Formula | C11H10Cl2N4 |
| Mol Weight | 269.13 |
| CoA | CoA of Metoprine |
| Smiles: | CC1=C(C(N)=NC(N)=N1)C2=CC=C(C(Cl)=C2)Cl |
|---|
KEYWORDS: buy Metoprine | Metoprine supplier | purchase | cost | manufacturer | order | distributor | buy 7761-45-7 | 7761-45-7 supplier