Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9574 | Purity: >98% |
 | |
| Chemical structure of WAY-326312 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 869875-89-8 |
|---|---|
| Purity | >98% |
| Formula | C20H18ClN3O3 |
| Mol Weight | 383.828 |
| CoA | CoA of WAY-326312 |
| Smiles: | CCOC1=CC=CC=C1NC(=O)C2=NN(C(=CC2=O)C)C3=CC=C(C=C3)Cl |
|---|
KEYWORDS: buy WAY-326312 | WAY-326312 supplier | purchase | cost | manufacturer | order | distributor | buy 869875-89-8 | 869875-89-8 supplier