Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10409 | Purity: >98% |
 | |
| Chemical structure of Senaparib |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1401682-78-7 |
|---|---|
| Purity | >98% |
| Formula | C24H20F2N6O3 |
| Mol Weight | 478.4508 |
| CoA | CoA of Senaparib |
| Smiles: | O=C(N1)N(CC2=CC=C(F)C(C(N3CCN(C4=NC=CC=N4)CC3)=O)=C2)C5=C(C(F)=CC=C5)C1=O |
|---|
KEYWORDS: buy Senaparib | Senaparib supplier | purchase | cost | manufacturer | order | distributor | buy 1401682-78-7 | 1401682-78-7 supplier