Product Information:
| Cat. No.: EX-A3967 | Purity: >98% |
![]() | |
| Chemical structure of PROTAC FAK degrader 1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2301916-69-6 |
|---|---|
| Purity | >98% |
| Formula | C47H56F3N9O8S2 |
| Mol Weight | 996.128 |
| CoA | CoA of PROTAC FAK degrader 1 |
| Smiles: | O=C(N[C@H](C(N1[C@H](C(NCC2=CC=C(C3=C(C)N=CS3)C=C2)=O)C[C@@H](O)C1)=O)C(C)(C)C)CCOCCOC4=CC=C(NC5=NC(NCC6=CC=CC(N(C)S(C)(=O)=O)=C6)=C(C(F)(F)F)C=N5)C=C4 |
|---|
KEYWORDS: buy PROTAC FAK degrader 1 | PROTAC FAK degrader 1 supplier | purchase | cost | manufacturer | order | distributor | buy 2301916-69-6 | 2301916-69-6 supplier


Inhibitor Specialist
