Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2479 | Purity: >98% |
 | |
| Chemical structure of MK-8998 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 953778-58-0 |
|---|---|
| Purity | >98% |
| Formula | C20H23F3N2O2 |
| Mol Weight | 380.404 |
| CoA | CoA of MK-8998 |
| Smiles: | CC(C)C1=CC=C(CC(=O)N[C@H](C)C2=NC=C(OCC(F)(F)F)C=C2)C=C1 |
|---|
KEYWORDS: buy MK-8998 | MK-8998 supplier | purchase | cost | manufacturer | order | distributor | buy 953778-58-0 | 953778-58-0 supplier