Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2867 | Purity: >98% |
 | |
| Chemical structure of Imidazenil |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 151271-08-8 |
|---|---|
| Purity | >98% |
| Formula | C18H12BrFN4O |
| Mol Weight | 399.216 |
| CoA | CoA of Imidazenil |
| Smiles: | NC(=O)C1=C2CN=C(C3=CC=CC=C3Br)C3=CC(F)=CC=C3N2C=N1 |
|---|
KEYWORDS: buy Imidazenil | Imidazenil supplier | purchase | cost | manufacturer | order | distributor | buy 151271-08-8 | 151271-08-8 supplier