Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A7753 | Purity: >98% |
 | |
| Chemical structure of Flubrotizolam |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 57801-95-3 |
|---|---|
| Purity | >98% |
| Formula | C15H10BrFN4S |
| Mol Weight | 377.234 |
| CoA | CoA of Flubrotizolam |
| Smiles: | CC1=NN=C2N1C3=C(C=C(S3)Br)C(=NC2)C4=CC=CC=C4F |
|---|
KEYWORDS: buy Flubrotizolam | Flubrotizolam supplier | purchase | cost | manufacturer | order | distributor | buy 57801-95-3 | 57801-95-3 supplier