Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1284 | Purity: >98% |
 | |
| Chemical structure of ETP-46321 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1252594-99-2 |
|---|---|
| Purity | >98% |
| Formula | C20H27N9O3S |
| Mol Weight | 473.552 |
| CoA | CoA of ETP-46321 |
| Smiles: | CS(=O)(=O)N1CCN(CC2=CN3C=C(N=C(N4CCOCC4)C3=N2)C2=CN=C(N)N=C2)CC1 |
|---|
KEYWORDS: buy ETP-46321 | ETP-46321 supplier | purchase | cost | manufacturer | order | distributor | buy 1252594-99-2 | 1252594-99-2 supplier