Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A663 | Purity: >98% |
 | |
| Chemical structure of Blonanserin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 132810-10-7 |
|---|---|
| Purity | >98% |
| Formula | C23H30FN3 |
| Mol Weight | 367.5028 |
| CoA | CoA of Blonanserin |
| Smiles: | CCN1CCN(CC1)C1=CC(C2=CC=C(F)C=C2)=C2CCCCCCC2=N1 |
|---|
KEYWORDS: buy Blonanserin | Blonanserin supplier | purchase | cost | manufacturer | order | distributor | buy 132810-10-7 | 132810-10-7 supplier