Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A362 | Purity: >98% |
 | |
| Chemical structure of AAE-581 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Balicatib |
|---|---|
| CAS No. | 354813-19-7 |
| Purity | >98% |
| Formula | C23H33N5O2 |
| Mol Weight | 411.5404 |
| CoA | CoA of AAE-581 |
| Smiles: | CCCN1CCN(CC1)C1=CC=C(C=C1)C(=O)NC1(CCCCC1)C(=O)NCC#N |
|---|
KEYWORDS: buy AAE-581 | AAE-581 supplier | purchase | cost | manufacturer | order | distributor | buy 354813-19-7 | 354813-19-7 supplier